C24H13F3N6O4S — CID 137258932
4-(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-[4-(trifluoromethoxy)phenyl]oxadiazol-3-ium-5-olate (PubChem CID 137258932) has the molecular formula C24H13F3N6O4S and a molecular weight of 538.47 g/mol. Its IUPAC name is 4-(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-[4-(trifluoromethoxy)phenyl]oxadiazol-3-ium-5-olate.
| Compound Name | 4-(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-[4-(trifluoromethoxy)phenyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 137258932 |
| Molecular Formula | C24H13F3N6O4S |
| Molecular Weight | 538.47 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 4-(3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-[4-(trifluoromethoxy)phenyl]oxadiazol-3-ium-5-olate |
| SMILES | N#Cc1c(N)nc2sc(C(=O)c3c([O-])on[n+]3-c3ccc(OC(F)(F)F)cc3)c(N)c2c1-c1ccccc1 |
| InChI | InChI=1S/C24H13F3N6O4S/c25-24(26,27)36-13-8-6-12(7-9-13)33-18(23(35)37-32-33)19(34)20-17(29)16-15(11-4-2-1-3-5-11)14(10-28)21(30)31-22(16)38-20/h1-9H,(H4-,29,30,31,32,34,35) |
| InChIKey | ACFFVIGGHDFJAM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 167.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|