C22H14N6O4S — CID 137303885
4-[3,6-diamino-5-cyano-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carbonyl]-3-(4-methylphenyl)oxadiazol-3-ium-5-olate (PubChem CID 137303885) has the molecular formula C22H14N6O4S and a molecular weight of 458.46 g/mol. Its IUPAC name is 4-[3,6-diamino-5-cyano-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carbonyl]-3-(4-methylphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[3,6-diamino-5-cyano-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carbonyl]-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 137303885 |
| Molecular Formula | C22H14N6O4S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 4-[3,6-diamino-5-cyano-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carbonyl]-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
| SMILES | Cc1ccc(-[n+]2noc([O-])c2C(=O)c2sc3nc(N)c(C#N)c(-c4ccco4)c3c2N)cc1 |
| InChI | InChI=1S/C22H14N6O4S/c1-10-4-6-11(7-5-10)28-17(22(30)32-27-28)18(29)19-16(24)15-14(13-3-2-8-31-13)12(9-23)20(25)26-21(15)33-19/h2-8H,1H3,(H4-,24,25,26,27,29,30) |
| InChIKey | LHFQSBIJEGRSES-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 171.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|