C22H14N6O3S2 — CID 137303904
4-(3,6-diamino-5-cyano-4-thiophen-3-ylthieno[2,3-b]pyridine-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate (PubChem CID 137303904) has the molecular formula C22H14N6O3S2 and a molecular weight of 474.53 g/mol. Its IUPAC name is 4-(3,6-diamino-5-cyano-4-thiophen-3-ylthieno[2,3-b]pyridine-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-(3,6-diamino-5-cyano-4-thiophen-3-ylthieno[2,3-b]pyridine-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 137303904 |
| Molecular Formula | C22H14N6O3S2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 4-(3,6-diamino-5-cyano-4-thiophen-3-ylthieno[2,3-b]pyridine-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
| SMILES | Cc1ccc(-[n+]2noc([O-])c2C(=O)c2sc3nc(N)c(C#N)c(-c4ccsc4)c3c2N)cc1 |
| InChI | InChI=1S/C22H14N6O3S2/c1-10-2-4-12(5-3-10)28-17(22(30)31-27-28)18(29)19-16(24)15-14(11-6-7-32-9-11)13(8-23)20(25)26-21(15)33-19/h2-7,9H,1H3,(H4-,24,25,26,27,29,30) |
| InChIKey | ZJRUCJXRLMWESZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|