C23H16N4O3S — CID 53296413
4-[3-amino-6-(4-methylphenyl)thieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 53296413) has the molecular formula C23H16N4O3S and a molecular weight of 428.47 g/mol. Its IUPAC name is 4-[3-amino-6-(4-methylphenyl)thieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[3-amino-6-(4-methylphenyl)thieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296413 |
| Molecular Formula | C23H16N4O3S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 4-[3-amino-6-(4-methylphenyl)thieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | Cc1ccc(-c2ccc3c(N)c(C(=O)c4c([O-])on[n+]4-c4ccccc4)sc3n2)cc1 |
| InChI | InChI=1S/C23H16N4O3S/c1-13-7-9-14(10-8-13)17-12-11-16-18(24)21(31-22(16)25-17)20(28)19-23(29)30-26-27(19)15-5-3-2-4-6-15/h2-12H,1H3,(H2-,24,26,28,29) |
| InChIKey | XTYXAVVGSZAJKY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|