C22H13ClN4O3S — CID 53296417
4-[3-amino-6-(4-chlorophenyl)thieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 53296417) has the molecular formula C22H13ClN4O3S and a molecular weight of 448.89 g/mol. Its IUPAC name is 4-[3-amino-6-(4-chlorophenyl)thieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[3-amino-6-(4-chlorophenyl)thieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53296417 |
| Molecular Formula | C22H13ClN4O3S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 4-[3-amino-6-(4-chlorophenyl)thieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | Nc1c(C(=O)c2c([O-])on[n+]2-c2ccccc2)sc2nc(-c3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C22H13ClN4O3S/c23-13-8-6-12(7-9-13)16-11-10-15-17(24)20(31-21(15)25-16)19(28)18-22(29)30-26-27(18)14-4-2-1-3-5-14/h1-11H,(H2-,24,26,28,29) |
| InChIKey | BLDUSGPMIBRTAU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|