C33H22N4O3S — CID 53294962
4-[3-amino-4-(4-methylphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 53294962) has the molecular formula C33H22N4O3S and a molecular weight of 554.63 g/mol. Its IUPAC name is 4-[3-amino-4-(4-methylphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[3-amino-4-(4-methylphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53294962 |
| Molecular Formula | C33H22N4O3S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | 4-[3-amino-4-(4-methylphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | Cc1ccc(-c2cc(-c3cccc4ccccc34)nc3sc(C(=O)c4c([O-])on[n+]4-c4ccccc4)c(N)c23)cc1 |
| InChI | InChI=1S/C33H22N4O3S/c1-19-14-16-21(17-15-19)25-18-26(24-13-7-9-20-8-5-6-12-23(20)24)35-32-27(25)28(34)31(41-32)30(38)29-33(39)40-36-37(29)22-10-3-2-4-11-22/h2-18H,1H3,(H2-,34,36,38,39) |
| InChIKey | SMEXYYLHTSCJKY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|