C28H21N4O4S+ — CID 53296844
4-[3-amino-4-(4-methoxyphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-3-methyl-2H-oxadiazol-3-ium-5-one (PubChem CID 53296844) has the molecular formula C28H21N4O4S+ and a molecular weight of 509.57 g/mol. Its IUPAC name is 4-[3-amino-4-(4-methoxyphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-3-methyl-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[3-amino-4-(4-methoxyphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-3-methyl-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53296844 |
| Molecular Formula | C28H21N4O4S+ |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 4-[3-amino-4-(4-methoxyphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-3-methyl-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(-c2cc(-c3cccc4ccccc34)nc3sc(C(=O)c4c(=O)o[nH][n+]4C)c(N)c23)cc1 |
| InChI | InChI=1S/C28H20N4O4S/c1-32-24(28(34)36-31-32)25(33)26-23(29)22-20(16-10-12-17(35-2)13-11-16)14-21(30-27(22)37-26)19-9-5-7-15-6-3-4-8-18(15)19/h3-14H,1-2H3,(H2-,29,31,33,34)/p+1 |
| InChIKey | KZOFVLKHDINSBG-UHFFFAOYSA-O |
| XLogP | 4.71 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|