C25H21N4O5S+ — CID 53296726
4-[3-amino-4-(2,5-dimethoxyphenyl)-6-phenylthieno[2,3-b]pyridine-2-carbonyl]-3-methyl-2H-oxadiazol-3-ium-5-one (PubChem CID 53296726) has the molecular formula C25H21N4O5S+ and a molecular weight of 489.53 g/mol. Its IUPAC name is 4-[3-amino-4-(2,5-dimethoxyphenyl)-6-phenylthieno[2,3-b]pyridine-2-carbonyl]-3-methyl-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[3-amino-4-(2,5-dimethoxyphenyl)-6-phenylthieno[2,3-b]pyridine-2-carbonyl]-3-methyl-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53296726 |
| Molecular Formula | C25H21N4O5S+ |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 4-[3-amino-4-(2,5-dimethoxyphenyl)-6-phenylthieno[2,3-b]pyridine-2-carbonyl]-3-methyl-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(OC)c(-c2cc(-c3ccccc3)nc3sc(C(=O)c4c(=O)o[nH][n+]4C)c(N)c23)c1 |
| InChI | InChI=1S/C25H20N4O5S/c1-29-21(25(31)34-28-29)22(30)23-20(26)19-16(15-11-14(32-2)9-10-18(15)33-3)12-17(27-24(19)35-23)13-7-5-4-6-8-13/h4-12H,1-3H3,(H2-,26,28,30,31)/p+1 |
| InChIKey | FMLBKKWKHILBOP-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|