C33H23N5O3S — CID 137258869
[3-amino-4-(4-methoxyphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-(3-phenyloxadiazol-3-ium-5-yl)azanide (PubChem CID 137258869) has the molecular formula C33H23N5O3S and a molecular weight of 569.65 g/mol. Its IUPAC name is [3-amino-4-(4-methoxyphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-(3-phenyloxadiazol-3-ium-5-yl)azanide.
| Compound Name | [3-amino-4-(4-methoxyphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-(3-phenyloxadiazol-3-ium-5-yl)azanide |
|---|---|
| PubChem CID | 137258869 |
| Molecular Formula | C33H23N5O3S |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | [3-amino-4-(4-methoxyphenyl)-6-naphthalen-1-ylthieno[2,3-b]pyridine-2-carbonyl]-(3-phenyloxadiazol-3-ium-5-yl)azanide |
| SMILES | COc1ccc(-c2cc(-c3cccc4ccccc34)nc3sc(C(=O)[N-]c4c[n+](-c5ccccc5)no4)c(N)c23)cc1 |
| InChI | InChI=1S/C33H23N5O3S/c1-40-23-16-14-21(15-17-23)26-18-27(25-13-7-9-20-8-5-6-12-24(20)25)35-33-29(26)30(34)31(42-33)32(39)36-28-19-38(37-41-28)22-10-3-2-4-11-22/h2-19H,1H3,(H2-,34,36,37,39) |
| InChIKey | HABUVUDNCBDLQR-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|