About 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one
4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one (PubChem CID 53296810) has the molecular formula C13H13N4O3S+
and a molecular weight of 305.34 g/mol. Its IUPAC name is 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one.
Molecular Properties
| Compound Name | 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one |
| PubChem CID | 53296810 |
| Molecular Formula | C13H13N4O3S+ |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one |
| SMILES | Cc1cc2c(N)c(C(=O)c3c(=O)o[nH][n+]3C)sc2nc1C |
| InChI | InChI=1S/C13H12N4O3S/c1-5-4-7-8(14)11(21-12(7)15-6(5)2)10(18)9-13(19)20-16-17(9)3/h4H,1-3H3,(H2-,14,16,18,19)/p+1 |
| InChIKey | RYRYSSQEMYBPCO-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one?
The IUPAC name of 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one (CID 53296810) is 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one.
What is the SMILES notation for 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one?
The canonical SMILES for 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one is Cc1cc2c(N)c(C(=O)c3c(=O)o[nH][n+]3C)sc2nc1C.
What is the InChIKey of 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one?
The InChIKey is RYRYSSQEMYBPCO-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H12N4O3S/c1-5-4-7-8(14)11(21-12(7)15-6(5)2)10(18)9-13(19)20-16-17(9)3/h4H,1-3H3,(H2-,14,16,18,19)/p+1.
What are the key properties of 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one?
4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one has a molecular weight of 305.34 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-5,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)-3-methyl-2H-oxadiazol-3-ium-5-one is sourced from PubChem (CID 53296810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).