C24H16N4O5S — CID 137303868
4-[3-amino-6-(1,3-benzodioxol-5-yl)thieno[2,3-b]pyridine-2-carbonyl]-3-(4-methylphenyl)oxadiazol-3-ium-5-olate (PubChem CID 137303868) has the molecular formula C24H16N4O5S and a molecular weight of 472.48 g/mol. Its IUPAC name is 4-[3-amino-6-(1,3-benzodioxol-5-yl)thieno[2,3-b]pyridine-2-carbonyl]-3-(4-methylphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[3-amino-6-(1,3-benzodioxol-5-yl)thieno[2,3-b]pyridine-2-carbonyl]-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 137303868 |
| Molecular Formula | C24H16N4O5S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 4-[3-amino-6-(1,3-benzodioxol-5-yl)thieno[2,3-b]pyridine-2-carbonyl]-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
| SMILES | Cc1ccc(-[n+]2noc([O-])c2C(=O)c2sc3nc(-c4ccc5c(c4)OCO5)ccc3c2N)cc1 |
| InChI | InChI=1S/C24H16N4O5S/c1-12-2-5-14(6-3-12)28-20(24(30)33-27-28)21(29)22-19(25)15-7-8-16(26-23(15)34-22)13-4-9-17-18(10-13)32-11-31-17/h2-10H,11H2,1H3,(H2-,25,27,29,30) |
| InChIKey | PVCOHBRVFMSKLB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|