C21H18N4O3S — CID 137303846
4-(3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate (PubChem CID 137303846) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 4-(3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-(3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 137303846 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 4-(3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
| SMILES | Cc1ccc(-[n+]2noc([O-])c2C(=O)c2sc3nc4c(cc3c2N)CCCC4)cc1 |
| InChI | InChI=1S/C21H18N4O3S/c1-11-6-8-13(9-7-11)25-17(21(27)28-24-25)18(26)19-16(22)14-10-12-4-2-3-5-15(12)23-20(14)29-19/h6-10H,2-5H2,1H3,(H2-,22,24,26,27) |
| InChIKey | UCWFYELOCQJIDF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|