C26H20N4O4S — CID 137259009
4-(5-acetyl-3-amino-6-methyl-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate (PubChem CID 137259009) has the molecular formula C26H20N4O4S and a molecular weight of 484.54 g/mol. Its IUPAC name is 4-(5-acetyl-3-amino-6-methyl-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-(5-acetyl-3-amino-6-methyl-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 137259009 |
| Molecular Formula | C26H20N4O4S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 4-(5-acetyl-3-amino-6-methyl-4-phenylthieno[2,3-b]pyridine-2-carbonyl)-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
| SMILES | CC(=O)c1c(C)nc2sc(C(=O)c3c([O-])on[n+]3-c3ccc(C)cc3)c(N)c2c1-c1ccccc1 |
| InChI | InChI=1S/C26H20N4O4S/c1-13-9-11-17(12-10-13)30-22(26(33)34-29-30)23(32)24-21(27)20-19(16-7-5-4-6-8-16)18(15(3)31)14(2)28-25(20)35-24/h4-12H,1-3H3,(H2-,27,29,32,33) |
| InChIKey | ZFBDSSVTIRMQKT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 126.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|