C21H13N6O3S2+ — CID 53296588
3,6-diamino-2-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-carbonyl)-4-thiophen-3-ylthieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 53296588) has the molecular formula C21H13N6O3S2+ and a molecular weight of 461.51 g/mol. Its IUPAC name is 3,6-diamino-2-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-carbonyl)-4-thiophen-3-ylthieno[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 3,6-diamino-2-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-carbonyl)-4-thiophen-3-ylthieno[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 53296588 |
| Molecular Formula | C21H13N6O3S2+ |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 3,6-diamino-2-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-carbonyl)-4-thiophen-3-ylthieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc2sc(C(=O)c3c(=O)o[nH][n+]3-c3ccccc3)c(N)c2c1-c1ccsc1 |
| InChI | InChI=1S/C21H12N6O3S2/c22-8-12-13(10-6-7-31-9-10)14-15(23)18(32-20(14)25-19(12)24)17(28)16-21(29)30-26-27(16)11-4-2-1-3-5-11/h1-7,9H,(H4-,23,24,25,26,28,29)/p+1 |
| InChIKey | CDCNVSBKUUYUIV-UHFFFAOYSA-O |
| XLogP | 2.85 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|