C22H16N7O3S+ — CID 53295911
3,6-diamino-5-cyano-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-N-naphthalen-2-ylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 53295911) has the molecular formula C22H16N7O3S+ and a molecular weight of 458.48 g/mol. Its IUPAC name is 3,6-diamino-5-cyano-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-N-naphthalen-2-ylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3,6-diamino-5-cyano-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-N-naphthalen-2-ylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 53295911 |
| Molecular Formula | C22H16N7O3S+ |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 3,6-diamino-5-cyano-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)-N-naphthalen-2-ylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | C[n+]1[nH]oc(=O)c1-c1c(C#N)c(N)nc2sc(C(=O)Nc3ccc4ccccc4c3)c(N)c12 |
| InChI | InChI=1S/C22H15N7O3S/c1-29-17(22(31)32-28-29)14-13(9-23)19(25)27-21-15(14)16(24)18(33-21)20(30)26-12-7-6-10-4-2-3-5-11(10)8-12/h2-8H,1H3,(H5-,24,25,26,27,28,30,31)/p+1 |
| InChIKey | HCKZFXZOXGMKKZ-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 167.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|