C23H20N4O2S — CID 176710001
2-amino-6-benzylsulfanyl-4-[4-(2-methoxyethoxy)phenyl]pyridine-3,5-dicarbonitrile (PubChem CID 176710001) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-amino-6-benzylsulfanyl-4-[4-(2-methoxyethoxy)phenyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-benzylsulfanyl-4-[4-(2-methoxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 176710001 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-amino-6-benzylsulfanyl-4-[4-(2-methoxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
| SMILES | COCCOc1ccc(-c2c(C#N)c(N)nc(SCc3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C23H20N4O2S/c1-28-11-12-29-18-9-7-17(8-10-18)21-19(13-24)22(26)27-23(20(21)14-25)30-15-16-5-3-2-4-6-16/h2-10H,11-12,15H2,1H3,(H2,26,27) |
| InChIKey | LYBLZMLXWKNOOV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|