C20H12ClN3S — CID 87084371
2-benzylsulfanyl-6-chloro-4-phenylpyridine-3,5-dicarbonitrile (PubChem CID 87084371) has the molecular formula C20H12ClN3S and a molecular weight of 361.86 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-chloro-4-phenylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-benzylsulfanyl-6-chloro-4-phenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 87084371 |
| Molecular Formula | C20H12ClN3S |
| Molecular Weight | 361.86 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-benzylsulfanyl-6-chloro-4-phenylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(Cl)nc(SCc2ccccc2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C20H12ClN3S/c21-19-16(11-22)18(15-9-5-2-6-10-15)17(12-23)20(24-19)25-13-14-7-3-1-4-8-14/h1-10H,13H2 |
| InChIKey | PTHGIYNAYGZSRX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.86 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|