C51H51N9OS2 — CID 163330848
bis(2-amino-6-[(4-tert-butylphenyl)methylsulfanyl]-4-phenylpyridine-3,5-dicarbonitrile);N,N-dimethylformamide (PubChem CID 163330848) has the molecular formula C51H51N9OS2 and a molecular weight of 870.16 g/mol. Its IUPAC name is bis(2-amino-6-[(4-tert-butylphenyl)methylsulfanyl]-4-phenylpyridine-3,5-dicarbonitrile);N,N-dimethylformamide.
| Compound Name | bis(2-amino-6-[(4-tert-butylphenyl)methylsulfanyl]-4-phenylpyridine-3,5-dicarbonitrile);N,N-dimethylformamide |
|---|---|
| PubChem CID | 163330848 |
| Molecular Formula | C51H51N9OS2 |
| Molecular Weight | 870.16 g/mol |
| Exact Mass | 869.37 |
| IUPAC Name | bis(2-amino-6-[(4-tert-butylphenyl)methylsulfanyl]-4-phenylpyridine-3,5-dicarbonitrile);N,N-dimethylformamide |
| SMILES | CC(C)(C)c1ccc(CSc2nc(N)c(C#N)c(-c3ccccc3)c2C#N)cc1.CC(C)(C)c1ccc(CSc2nc(N)c(C#N)c(-c3ccccc3)c2C#N)cc1.CN(C)C=O |
| InChI | InChI=1S/2C24H22N4S.C3H7NO/c2*1-24(2,3)18-11-9-16(10-12-18)15-29-23-20(14-26)21(17-7-5-4-6-8-17)19(13-25)22(27)28-23;1-4(2)3-5/h2*4-12H,15H2,1-3H3,(H2,27,28);3H,1-2H3 |
| InChIKey | MBOYBMOKNWHNBN-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 193.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.16 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|