C13H12N4S2 — CID 135005337
4-amino-6-benzylsulfanyl-2-methylsulfanylpyrimidine-5-carbonitrile (PubChem CID 135005337) has the molecular formula C13H12N4S2 and a molecular weight of 288.40 g/mol. Its IUPAC name is 4-amino-6-benzylsulfanyl-2-methylsulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-benzylsulfanyl-2-methylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135005337 |
| Molecular Formula | C13H12N4S2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-amino-6-benzylsulfanyl-2-methylsulfanylpyrimidine-5-carbonitrile |
| SMILES | CSc1nc(N)c(C#N)c(SCc2ccccc2)n1 |
| InChI | InChI=1S/C13H12N4S2/c1-18-13-16-11(15)10(7-14)12(17-13)19-8-9-5-3-2-4-6-9/h2-6H,8H2,1H3,(H2,15,16,17) |
| InChIKey | ICKKKPPDFDOGFY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |