C16H14N4S — CID 745538
2-amino-6-benzylsulfanyl-4-ethylpyridine-3,5-dicarbonitrile (PubChem CID 745538) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-amino-6-benzylsulfanyl-4-ethylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-benzylsulfanyl-4-ethylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 745538 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-amino-6-benzylsulfanyl-4-ethylpyridine-3,5-dicarbonitrile |
| SMILES | CCc1c(C#N)c(N)nc(SCc2ccccc2)c1C#N |
| InChI | InChI=1S/C16H14N4S/c1-2-12-13(8-17)15(19)20-16(14(12)9-18)21-10-11-6-4-3-5-7-11/h3-7H,2,10H2,1H3,(H2,19,20) |
| InChIKey | PGUDRZIFZXFYHC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |