C14H11N5S2 — CID 15370313
4-amino-2-[(4-cyanophenyl)methylsulfanyl]-6-methylsulfanylpyrimidine-5-carbonitrile (PubChem CID 15370313) has the molecular formula C14H11N5S2 and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-amino-2-[(4-cyanophenyl)methylsulfanyl]-6-methylsulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-[(4-cyanophenyl)methylsulfanyl]-6-methylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 15370313 |
| Molecular Formula | C14H11N5S2 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4-amino-2-[(4-cyanophenyl)methylsulfanyl]-6-methylsulfanylpyrimidine-5-carbonitrile |
| SMILES | CSc1nc(SCc2ccc(C#N)cc2)nc(N)c1C#N |
| InChI | InChI=1S/C14H11N5S2/c1-20-13-11(7-16)12(17)18-14(19-13)21-8-10-4-2-9(6-15)3-5-10/h2-5H,8H2,1H3,(H2,17,18,19) |
| InChIKey | NGTVYVGRZQKYCS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |