C15H15BrN4S — CID 100775958
4-amino-2-[(4-bromophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine-5-carbonitrile (PubChem CID 100775958) has the molecular formula C15H15BrN4S and a molecular weight of 363.28 g/mol. Its IUPAC name is 4-amino-2-[(4-bromophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-[(4-bromophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 100775958 |
| Molecular Formula | C15H15BrN4S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 4-amino-2-[(4-bromophenyl)methylsulfanyl]-6-propan-2-ylpyrimidine-5-carbonitrile |
| SMILES | CC(C)c1nc(SCc2ccc(Br)cc2)nc(N)c1C#N |
| InChI | InChI=1S/C15H15BrN4S/c1-9(2)13-12(7-17)14(18)20-15(19-13)21-8-10-3-5-11(16)6-4-10/h3-6,9H,8H2,1-2H3,(H2,18,19,20) |
| InChIKey | JDKMDQWYVWUHGQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |