About benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate
benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate (PubChem CID 1076770) has the molecular formula C22H16N4O2S
and a molecular weight of 400.46 g/mol. Its IUPAC name is benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate |
| PubChem CID | 1076770 |
| Molecular Formula | C22H16N4O2S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate |
| SMILES | N#Cc1c(N)nc(SCC(=O)OCc2ccccc2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C22H16N4O2S/c23-11-17-20(16-9-5-2-6-10-16)18(12-24)22(26-21(17)25)29-14-19(27)28-13-15-7-3-1-4-8-15/h1-10H,13-14H2,(H2,25,26) |
| InChIKey | WRSAERQFZMYQDN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate?
The IUPAC name of benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate (CID 1076770) is benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate.
What is the SMILES notation for benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate?
The canonical SMILES for benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate is N#Cc1c(N)nc(SCC(=O)OCc2ccccc2)c(C#N)c1-c1ccccc1.
What is the InChIKey of benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate?
The InChIKey is WRSAERQFZMYQDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4O2S/c23-11-17-20(16-9-5-2-6-10-16)18(12-24)22(26-21(17)25)29-14-19(27)28-13-15-7-3-1-4-8-15/h1-10H,13-14H2,(H2,25,26).
What are the key properties of benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate?
benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate has a molecular weight of 400.46 g/mol, XLogP of 3.91, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]acetate is sourced from PubChem (CID 1076770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).