C21H13ClN4OS — CID 1046975
2-amino-4-(4-chlorophenyl)-6-phenacylsulfanylpyridine-3,5-dicarbonitrile (PubChem CID 1046975) has the molecular formula C21H13ClN4OS and a molecular weight of 404.88 g/mol. Its IUPAC name is 2-amino-4-(4-chlorophenyl)-6-phenacylsulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(4-chlorophenyl)-6-phenacylsulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 1046975 |
| Molecular Formula | C21H13ClN4OS |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-amino-4-(4-chlorophenyl)-6-phenacylsulfanylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SCC(=O)c2ccccc2)c(C#N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H13ClN4OS/c22-15-8-6-14(7-9-15)19-16(10-23)20(25)26-21(17(19)11-24)28-12-18(27)13-4-2-1-3-5-13/h1-9H,12H2,(H2,25,26) |
| InChIKey | YVRCRZSPSOWQQE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |