C24H23ClN4O2S — CID 176710005
2-chloro-4-[4-(2-hydroxypropoxy)phenyl]-6-(pyridin-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile;ethane (PubChem CID 176710005) has the molecular formula C24H23ClN4O2S and a molecular weight of 466.99 g/mol. Its IUPAC name is 2-chloro-4-[4-(2-hydroxypropoxy)phenyl]-6-(pyridin-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile;ethane.
| Compound Name | 2-chloro-4-[4-(2-hydroxypropoxy)phenyl]-6-(pyridin-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile;ethane |
|---|---|
| PubChem CID | 176710005 |
| Molecular Formula | C24H23ClN4O2S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-chloro-4-[4-(2-hydroxypropoxy)phenyl]-6-(pyridin-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile;ethane |
| SMILES | CC.CC(O)COc1ccc(-c2c(C#N)c(Cl)nc(SCc3cccnc3)c2C#N)cc1 |
| InChI | InChI=1S/C22H17ClN4O2S.C2H6/c1-14(28)12-29-17-6-4-16(5-7-17)20-18(9-24)21(23)27-22(19(20)10-25)30-13-15-3-2-8-26-11-15;1-2/h2-8,11,14,28H,12-13H2,1H3;1-2H3 |
| InChIKey | QQIFQJVLJXLQEI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|