C23H15ClN4O2S — CID 88983227
2-chloro-6-[(3-cyanophenyl)methylsulfanyl]-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile (PubChem CID 88983227) has the molecular formula C23H15ClN4O2S and a molecular weight of 446.92 g/mol. Its IUPAC name is 2-chloro-6-[(3-cyanophenyl)methylsulfanyl]-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2-chloro-6-[(3-cyanophenyl)methylsulfanyl]-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 88983227 |
| Molecular Formula | C23H15ClN4O2S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 2-chloro-6-[(3-cyanophenyl)methylsulfanyl]-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1cccc(CSc2nc(Cl)c(C#N)c(-c3ccc(OCCO)cc3)c2C#N)c1 |
| InChI | InChI=1S/C23H15ClN4O2S/c24-22-19(12-26)21(17-4-6-18(7-5-17)30-9-8-29)20(13-27)23(28-22)31-14-16-3-1-2-15(10-16)11-25/h1-7,10,29H,8-9,14H2 |
| InChIKey | VTSSATJXTJLDJX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|