C18H15N5O2S — CID 169151815
2-amino-6-(2-cyanoethylsulfanyl)-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile (PubChem CID 169151815) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-amino-6-(2-cyanoethylsulfanyl)-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-(2-cyanoethylsulfanyl)-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169151815 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-amino-6-(2-cyanoethylsulfanyl)-4-[4-(2-hydroxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
| SMILES | N#CCCSc1nc(N)c(C#N)c(-c2ccc(OCCO)cc2)c1C#N |
| InChI | InChI=1S/C18H15N5O2S/c19-6-1-9-26-18-15(11-21)16(14(10-20)17(22)23-18)12-2-4-13(5-3-12)25-8-7-24/h2-5,24H,1,7-9H2,(H2,22,23) |
| InChIKey | QVUXIDPPJYCHAG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|