C20H19N5O2S — CID 176710025
2-(2-cyanoethylsulfanyl)-4-[4-(2-methoxyethoxy)phenyl]-6-(methylamino)pyridine-3,5-dicarbonitrile (PubChem CID 176710025) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-(2-cyanoethylsulfanyl)-4-[4-(2-methoxyethoxy)phenyl]-6-(methylamino)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-(2-cyanoethylsulfanyl)-4-[4-(2-methoxyethoxy)phenyl]-6-(methylamino)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 176710025 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-(2-cyanoethylsulfanyl)-4-[4-(2-methoxyethoxy)phenyl]-6-(methylamino)pyridine-3,5-dicarbonitrile |
| SMILES | CNc1nc(SCCC#N)c(C#N)c(-c2ccc(OCCOC)cc2)c1C#N |
| InChI | InChI=1S/C20H19N5O2S/c1-24-19-16(12-22)18(17(13-23)20(25-19)28-11-3-8-21)14-4-6-15(7-5-14)27-10-9-26-2/h4-7H,3,9-11H2,1-2H3,(H,24,25) |
| InChIKey | ZRIXVHQUUOYVCK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|