C23H24N4O3S — CID 176710072
2-(cyclopropylamino)-4-[4-(2-methoxyethoxy)phenyl]-6-(oxetan-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile (PubChem CID 176710072) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is 2-(cyclopropylamino)-4-[4-(2-methoxyethoxy)phenyl]-6-(oxetan-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-(cyclopropylamino)-4-[4-(2-methoxyethoxy)phenyl]-6-(oxetan-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 176710072 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-(cyclopropylamino)-4-[4-(2-methoxyethoxy)phenyl]-6-(oxetan-3-ylmethylsulfanyl)pyridine-3,5-dicarbonitrile |
| SMILES | COCCOc1ccc(-c2c(C#N)c(NC3CC3)nc(SCC3COC3)c2C#N)cc1 |
| InChI | InChI=1S/C23H24N4O3S/c1-28-8-9-30-18-6-2-16(3-7-18)21-19(10-24)22(26-17-4-5-17)27-23(20(21)11-25)31-14-15-12-29-13-15/h2-3,6-7,15,17H,4-5,8-9,12-14H2,1H3,(H,26,27) |
| InChIKey | FFRWGXLUSBVPDK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|