C21H26N4O3S — CID 169151765
2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-(2-methoxyethylsulfanyl)pyridine-3,5-dicarbonitrile;ethane (PubChem CID 169151765) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-(2-methoxyethylsulfanyl)pyridine-3,5-dicarbonitrile;ethane.
| Compound Name | 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-(2-methoxyethylsulfanyl)pyridine-3,5-dicarbonitrile;ethane |
|---|---|
| PubChem CID | 169151765 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-(2-methoxyethylsulfanyl)pyridine-3,5-dicarbonitrile;ethane |
| SMILES | CC.COCCOc1ccc(-c2c(C#N)c(N)nc(SCCOC)c2C#N)cc1 |
| InChI | InChI=1S/C19H20N4O3S.C2H6/c1-24-7-8-26-14-5-3-13(4-6-14)17-15(11-20)18(22)23-19(16(17)12-21)27-10-9-25-2;1-2/h3-6H,7-10H2,1-2H3,(H2,22,23);1-2H3 |
| InChIKey | IDPSCOVKTJOKAR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|