C23H21N5O2S — CID 169151836
2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-[(1S)-1-pyridin-3-ylethyl]sulfanylpyridine-3,5-dicarbonitrile (PubChem CID 169151836) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-[(1S)-1-pyridin-3-ylethyl]sulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-[(1S)-1-pyridin-3-ylethyl]sulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169151836 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-amino-4-[4-(2-methoxyethoxy)phenyl]-6-[(1S)-1-pyridin-3-ylethyl]sulfanylpyridine-3,5-dicarbonitrile |
| SMILES | COCCOc1ccc(-c2c(C#N)c(N)nc(S[C@@H](C)c3cccnc3)c2C#N)cc1 |
| InChI | InChI=1S/C23H21N5O2S/c1-15(17-4-3-9-27-14-17)31-23-20(13-25)21(19(12-24)22(26)28-23)16-5-7-18(8-6-16)30-11-10-29-2/h3-9,14-15H,10-11H2,1-2H3,(H2,26,28)/t15-/m0/s1 |
| InChIKey | OOBVCLGMMFOXAX-HNNXBMFYSA-N |
| XLogP | 4.35 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|