C20H18N4O3S — CID 58739929
methyl 2-[[6-amino-3,5-dicyano-4-(4-prop-2-enoxyphenyl)-2-pyridinyl]sulfanyl]propanoate (PubChem CID 58739929) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is methyl 2-[[6-amino-3,5-dicyano-4-(4-prop-2-enoxyphenyl)-2-pyridinyl]sulfanyl]propanoate.
| Compound Name | methyl 2-[[6-amino-3,5-dicyano-4-(4-prop-2-enoxyphenyl)-2-pyridinyl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 58739929 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | methyl 2-[[6-amino-3,5-dicyano-4-(4-prop-2-enoxyphenyl)-2-pyridinyl]sulfanyl]propanoate |
| SMILES | C=CCOc1ccc(-c2c(C#N)c(N)nc(SC(C)C(=O)OC)c2C#N)cc1 |
| InChI | InChI=1S/C20H18N4O3S/c1-4-9-27-14-7-5-13(6-8-14)17-15(10-21)18(23)24-19(16(17)11-22)28-12(2)20(25)26-3/h4-8,12H,1,9H2,2-3H3,(H2,23,24) |
| InChIKey | MTCNJXYKZUAUEO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|