C19H18N4O3S — CID 58739729
2-amino-6-(2,3-dihydroxypropylsulfanyl)-4-(4-prop-2-enoxyphenyl)pyridine-3,5-dicarbonitrile (PubChem CID 58739729) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 2-amino-6-(2,3-dihydroxypropylsulfanyl)-4-(4-prop-2-enoxyphenyl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-(2,3-dihydroxypropylsulfanyl)-4-(4-prop-2-enoxyphenyl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 58739729 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-amino-6-(2,3-dihydroxypropylsulfanyl)-4-(4-prop-2-enoxyphenyl)pyridine-3,5-dicarbonitrile |
| SMILES | C=CCOc1ccc(-c2c(C#N)c(N)nc(SCC(O)CO)c2C#N)cc1 |
| InChI | InChI=1S/C19H18N4O3S/c1-2-7-26-14-5-3-12(4-6-14)17-15(8-20)18(22)23-19(16(17)9-21)27-11-13(25)10-24/h2-6,13,24-25H,1,7,10-11H2,(H2,22,23) |
| InChIKey | YUBFPOLQTAMLNM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|