C20H16N4O3S — CID 58739394
2-amino-6-(2-oxooxolan-3-yl)sulfanyl-4-(4-prop-2-enoxyphenyl)pyridine-3,5-dicarbonitrile (PubChem CID 58739394) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-amino-6-(2-oxooxolan-3-yl)sulfanyl-4-(4-prop-2-enoxyphenyl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-(2-oxooxolan-3-yl)sulfanyl-4-(4-prop-2-enoxyphenyl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 58739394 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-amino-6-(2-oxooxolan-3-yl)sulfanyl-4-(4-prop-2-enoxyphenyl)pyridine-3,5-dicarbonitrile |
| SMILES | C=CCOc1ccc(-c2c(C#N)c(N)nc(SC3CCOC3=O)c2C#N)cc1 |
| InChI | InChI=1S/C20H16N4O3S/c1-2-8-26-13-5-3-12(4-6-13)17-14(10-21)18(23)24-19(15(17)11-22)28-16-7-9-27-20(16)25/h2-6,16H,1,7-9H2,(H2,23,24) |
| InChIKey | JJEUKRXWKMZXCA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|