C16H11N4OS- — CID 58739399
6-amino-3,5-dicyano-4-(4-prop-2-enoxyphenyl)pyridine-2-thiolate (PubChem CID 58739399) has the molecular formula C16H11N4OS- and a molecular weight of 307.36 g/mol. Its IUPAC name is 6-amino-3,5-dicyano-4-(4-prop-2-enoxyphenyl)pyridine-2-thiolate.
| Compound Name | 6-amino-3,5-dicyano-4-(4-prop-2-enoxyphenyl)pyridine-2-thiolate |
|---|---|
| PubChem CID | 58739399 |
| Molecular Formula | C16H11N4OS- |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 6-amino-3,5-dicyano-4-(4-prop-2-enoxyphenyl)pyridine-2-thiolate |
| SMILES | C=CCOc1ccc(-c2c(C#N)c(N)nc([S-])c2C#N)cc1 |
| InChI | InChI=1S/C16H12N4OS/c1-2-7-21-11-5-3-10(4-6-11)14-12(8-17)15(19)20-16(22)13(14)9-18/h2-6H,1,7H2,(H3,19,20,22)/p-1 |
| InChIKey | GELIIFLRCRFLTJ-UHFFFAOYSA-M |
| XLogP | 2.54 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|