C23H21IN5O2S- — CID 176710180
CID 176710180 (PubChem CID 176710180) has the molecular formula C23H21IN5O2S- and a molecular weight of 558.43 g/mol.
| Compound Name | CID 176710180 |
|---|---|
| PubChem CID | 176710180 |
| Molecular Formula | C23H21IN5O2S- |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | — |
| SMILES | CNc1nc(SCC2=C[I-]N=CC=C2)c(C#N)c(-c2ccc(OCCOC)cc2)c1C#N |
| InChI | InChI=1S/C23H21IN5O2S/c1-27-22-19(13-25)21(17-5-7-18(8-6-17)31-11-10-30-2)20(14-26)23(29-22)32-15-16-4-3-9-28-24-12-16/h3-9,12H,10-11,15H2,1-2H3,(H,27,29)/q-1 |
| InChIKey | RUOYUXXMYHPEOV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|