About CID 176710180
CID 176710180 (PubChem CID 176710180) has the molecular formula C23H21IN5O2S-
and a molecular weight of 558.43 g/mol.
Molecular Properties
| Compound Name | CID 176710180 |
| PubChem CID | 176710180 |
| Molecular Formula | C23H21IN5O2S- |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | — |
| SMILES | CNc1nc(SCC2=C[I-]N=CC=C2)c(C#N)c(-c2ccc(OCCOC)cc2)c1C#N |
| InChI | InChI=1S/C23H21IN5O2S/c1-27-22-19(13-25)21(17-5-7-18(8-6-17)31-11-10-30-2)20(14-26)23(29-22)32-15-16-4-3-9-28-24-12-16/h3-9,12H,10-11,15H2,1-2H3,(H,27,29)/q-1 |
| InChIKey | RUOYUXXMYHPEOV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 176710180 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176710180?
The IUPAC name of CID 176710180 (CID 176710180) is not available.
What is the SMILES notation for CID 176710180?
The canonical SMILES for CID 176710180 is CNc1nc(SCC2=C[I-]N=CC=C2)c(C#N)c(-c2ccc(OCCOC)cc2)c1C#N.
What is the InChIKey of CID 176710180?
The InChIKey is RUOYUXXMYHPEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21IN5O2S/c1-27-22-19(13-25)21(17-5-7-18(8-6-17)31-11-10-30-2)20(14-26)23(29-22)32-15-16-4-3-9-28-24-12-16/h3-9,12H,10-11,15H2,1-2H3,(H,27,29)/q-1.
What are the key properties of CID 176710180?
CID 176710180 has a molecular weight of 558.43 g/mol, XLogP of 1.18, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176710180 is sourced from PubChem (CID 176710180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).