C26H26N4O2S — CID 176710016
2-cyclopropyl-4-[4-(2-methoxyethoxy)phenyl]-6-[(Z)-2-methylidene-5-methyliminopent-3-enyl]sulfanylpyridine-3,5-dicarbonitrile (PubChem CID 176710016) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 2-cyclopropyl-4-[4-(2-methoxyethoxy)phenyl]-6-[(Z)-2-methylidene-5-methyliminopent-3-enyl]sulfanylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-cyclopropyl-4-[4-(2-methoxyethoxy)phenyl]-6-[(Z)-2-methylidene-5-methyliminopent-3-enyl]sulfanylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 176710016 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-cyclopropyl-4-[4-(2-methoxyethoxy)phenyl]-6-[(Z)-2-methylidene-5-methyliminopent-3-enyl]sulfanylpyridine-3,5-dicarbonitrile |
| SMILES | C=C(/C=C\C=N\C)CSc1nc(C2CC2)c(C#N)c(-c2ccc(OCCOC)cc2)c1C#N |
| InChI | InChI=1S/C26H26N4O2S/c1-18(5-4-12-29-2)17-33-26-23(16-28)24(22(15-27)25(30-26)20-6-7-20)19-8-10-21(11-9-19)32-14-13-31-3/h4-5,8-12,20H,1,6-7,13-14,17H2,2-3H3/b5-4-,29-12+ |
| InChIKey | AKBGJADMFDVGHM-KYMHBGJHSA-N |
| XLogP | 5.30 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|