C26H25FN4O2S — CID 176710000
2-(3-fluoroazetidin-1-yl)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanyl-4-[4-(2-methoxyethoxy)phenyl]pyridine-3,5-dicarbonitrile (PubChem CID 176710000) has the molecular formula C26H25FN4O2S and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-(3-fluoroazetidin-1-yl)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanyl-4-[4-(2-methoxyethoxy)phenyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2-(3-fluoroazetidin-1-yl)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanyl-4-[4-(2-methoxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 176710000 |
| Molecular Formula | C26H25FN4O2S |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-(3-fluoroazetidin-1-yl)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfanyl-4-[4-(2-methoxyethoxy)phenyl]pyridine-3,5-dicarbonitrile |
| SMILES | C=C/C(=C\C=C/C)Sc1nc(N2CC(F)C2)c(C#N)c(-c2ccc(OCCOC)cc2)c1C#N |
| InChI | InChI=1S/C26H25FN4O2S/c1-4-6-7-21(5-2)34-26-23(15-29)24(18-8-10-20(11-9-18)33-13-12-32-3)22(14-28)25(30-26)31-16-19(27)17-31/h4-11,19H,2,12-13,16-17H2,1,3H3/b6-4-,21-7+ |
| InChIKey | GZNGSSSSVZXXMO-KINPLGJRSA-N |
| XLogP | 5.41 |
| TPSA | 82.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|