About N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide
N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide (PubChem CID 58670186) has the molecular formula C19H19N5O2S
and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide |
| PubChem CID | 58670186 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide |
| SMILES | CCNc1nc(SCCO)c(C#N)c(-c2ccc(NC(C)=O)cc2)c1C#N |
| InChI | InChI=1S/C19H19N5O2S/c1-3-22-18-15(10-20)17(16(11-21)19(24-18)27-9-8-25)13-4-6-14(7-5-13)23-12(2)26/h4-7,25H,3,8-9H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | RPBWOFOYGKMCTP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide?
The IUPAC name of N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide (CID 58670186) is N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide?
The canonical SMILES for N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide is CCNc1nc(SCCO)c(C#N)c(-c2ccc(NC(C)=O)cc2)c1C#N.
What is the InChIKey of N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide?
The InChIKey is RPBWOFOYGKMCTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O2S/c1-3-22-18-15(10-20)17(16(11-21)19(24-18)27-9-8-25)13-4-6-14(7-5-13)23-12(2)26/h4-7,25H,3,8-9H2,1-2H3,(H,22,24)(H,23,26).
What are the key properties of N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide?
N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide has a molecular weight of 381.46 g/mol, XLogP of 2.97, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[3,5-dicyano-2-(ethylamino)-6-(2-hydroxyethylsulfanyl)-4-pyridinyl]phenyl]acetamide is sourced from PubChem (CID 58670186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).