C15H18N5O3S+ — CID 53295873
2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53295873) has the molecular formula C15H18N5O3S+ and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide.
| Compound Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 53295873 |
| Molecular Formula | C15H18N5O3S+ |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]acetamide |
| SMILES | COCC[n+]1cc(NC(=O)CSc2nc(C)cc(C)c2C#N)on1 |
| InChI | InChI=1S/C15H17N5O3S/c1-10-6-11(2)17-15(12(10)7-16)24-9-13(21)18-14-8-20(19-23-14)4-5-22-3/h6,8H,4-5,9H2,1-3H3/p+1 |
| InChIKey | UABWIAXUCIYYNP-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|