C17H21N6O2S+ — CID 53295173
2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53295173) has the molecular formula C17H21N6O2S+ and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53295173 |
| Molecular Formula | C17H21N6O2S+ |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide |
| SMILES | Cc1cc(C)c(C#N)c(SCC(=O)Nc2c[n+](N3CCCCC3)no2)n1 |
| InChI | InChI=1S/C17H20N6O2S/c1-12-8-13(2)19-17(14(12)9-18)26-11-15(24)20-16-10-23(21-25-16)22-6-4-3-5-7-22/h8,10H,3-7,11H2,1-2H3/p+1 |
| InChIKey | IMHALZXAYCUIHQ-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|