C18H23N6O2S+ — CID 53295175
2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53295175) has the molecular formula C18H23N6O2S+ and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53295175 |
| Molecular Formula | C18H23N6O2S+ |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide |
| SMILES | Cc1nc(SCC(=O)Nc2c[n+](N3CCCCC3)no2)c(C#N)c(C)c1C |
| InChI | InChI=1S/C18H22N6O2S/c1-12-13(2)15(9-19)18(20-14(12)3)27-11-16(25)21-17-10-24(22-26-17)23-7-5-4-6-8-23/h10H,4-8,11H2,1-3H3/p+1 |
| InChIKey | ZPJSWCSEOQJBDB-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|