C21H20ClN6O2S+ — CID 53295285
2-[[6-(4-chlorophenyl)-3-cyano-2-pyridinyl]sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53295285) has the molecular formula C21H20ClN6O2S+ and a molecular weight of 455.95 g/mol. Its IUPAC name is 2-[[6-(4-chlorophenyl)-3-cyano-2-pyridinyl]sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[[6-(4-chlorophenyl)-3-cyano-2-pyridinyl]sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53295285 |
| Molecular Formula | C21H20ClN6O2S+ |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-[[6-(4-chlorophenyl)-3-cyano-2-pyridinyl]sulfanyl]-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)acetamide |
| SMILES | N#Cc1ccc(-c2ccc(Cl)cc2)nc1SCC(=O)Nc1c[n+](N2CCCCC2)no1 |
| InChI | InChI=1S/C21H19ClN6O2S/c22-17-7-4-15(5-8-17)18-9-6-16(12-23)21(24-18)31-14-19(29)25-20-13-28(26-30-20)27-10-2-1-3-11-27/h4-9,13H,1-3,10-11,14H2/p+1 |
| InChIKey | USDLWJFJOHSPFQ-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|