C15H18N5O2S+ — CID 53277483
2-[(3-cyano-6-propyl-2-pyridinyl)sulfanyl]-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide (PubChem CID 53277483) has the molecular formula C15H18N5O2S+ and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[(3-cyano-6-propyl-2-pyridinyl)sulfanyl]-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide.
| Compound Name | 2-[(3-cyano-6-propyl-2-pyridinyl)sulfanyl]-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide |
|---|---|
| PubChem CID | 53277483 |
| Molecular Formula | C15H18N5O2S+ |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[(3-cyano-6-propyl-2-pyridinyl)sulfanyl]-N-(3-ethyloxadiazol-3-ium-5-yl)acetamide |
| SMILES | CCCc1ccc(C#N)c(SCC(=O)Nc2c[n+](CC)no2)n1 |
| InChI | InChI=1S/C15H17N5O2S/c1-3-5-12-7-6-11(8-16)15(17-12)23-10-13(21)18-14-9-20(4-2)19-22-14/h6-7,9H,3-5,10H2,1-2H3/p+1 |
| InChIKey | DNJKWDIGVQXNRR-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|