C17H23N3O2S — CID 7875972
2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-pentan-3-ylacetamide (PubChem CID 7875972) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-pentan-3-ylacetamide.
| Compound Name | 2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 7875972 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CSc1nc2ccccc2c(=O)n1CC |
| InChI | InChI=1S/C17H23N3O2S/c1-4-12(5-2)18-15(21)11-23-17-19-14-10-8-7-9-13(14)16(22)20(17)6-3/h7-10,12H,4-6,11H2,1-3H3,(H,18,21) |
| InChIKey | LALMNHKLXVITGM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |