C19H27N3O2S — CID 7456164
N-[(2S)-3-methylbutan-2-yl]-2-[3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 7456164) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-[(2S)-3-methylbutan-2-yl]-2-[3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[(2S)-3-methylbutan-2-yl]-2-[3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7456164 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[(2S)-3-methylbutan-2-yl]-2-[3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)Cn1c(SCC(=O)N[C@@H](C)C(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H27N3O2S/c1-12(2)10-22-18(24)15-8-6-7-9-16(15)21-19(22)25-11-17(23)20-14(5)13(3)4/h6-9,12-14H,10-11H2,1-5H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | WSMWXVSWYKJTDT-AWEZNQCLSA-N |
| XLogP | 3.31 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |