C15H18N4O3S — CID 4004415
N-carbamoyl-2-[3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 4004415) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-carbamoyl-2-[3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-carbamoyl-2-[3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4004415 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-carbamoyl-2-[3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)Cn1c(SCC(=O)NC(N)=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C15H18N4O3S/c1-9(2)7-19-13(21)10-5-3-4-6-11(10)17-15(19)23-8-12(20)18-14(16)22/h3-6,9H,7-8H2,1-2H3,(H3,16,18,20,22) |
| InChIKey | DAYJTRXFOFHMHL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |