C16H21N3O2S — CID 51140960
N-(3-methylbutan-2-yl)-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide (PubChem CID 51140960) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(3-methylbutan-2-yl)-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 51140960 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(3-methylbutan-2-yl)-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
| SMILES | CC(C)C(C)NC(=O)CSc1nc2ccccc2c(=O)n1C |
| InChI | InChI=1S/C16H21N3O2S/c1-10(2)11(3)17-14(20)9-22-16-18-13-8-6-5-7-12(13)15(21)19(16)4/h5-8,10-11H,9H2,1-4H3,(H,17,20) |
| InChIKey | NXUZCOFHSSDUAU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |