C29H28N4O5S — CID 16796688
N-(4,5-dimethyl-2-nitrophenyl)-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide (PubChem CID 16796688) has the molecular formula C29H28N4O5S and a molecular weight of 544.63 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-nitrophenyl)-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(4,5-dimethyl-2-nitrophenyl)-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 16796688 |
| Molecular Formula | C29H28N4O5S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-(4,5-dimethyl-2-nitrophenyl)-2-[(4Z)-1-(3,5-dimethylphenyl)-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide |
| SMILES | COc1ccc(/C=C2\N=C(SCC(=O)Nc3cc(C)c(C)cc3[N+](=O)[O-])N(c3cc(C)cc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C29H28N4O5S/c1-17-10-18(2)12-22(11-17)32-28(35)25(15-21-6-8-23(38-5)9-7-21)31-29(32)39-16-27(34)30-24-13-19(3)20(4)14-26(24)33(36)37/h6-15H,16H2,1-5H3,(H,30,34)/b25-15- |
| InChIKey | WASZJUUNNNRJGW-MYYYXRDXSA-N |
| XLogP | 5.95 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|