C28H24N4O7S — CID 4309653
2-[4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(5-methoxy-2-methyl-4-nitrophenyl)acetamide (PubChem CID 4309653) has the molecular formula C28H24N4O7S and a molecular weight of 560.59 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(5-methoxy-2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(5-methoxy-2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4309653 |
| Molecular Formula | C28H24N4O7S |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethylidene)-1-(4-methylphenyl)-5-oxoimidazol-2-yl]sulfanyl-N-(5-methoxy-2-methyl-4-nitrophenyl)acetamide |
| SMILES | COc1cc(NC(=O)CSC2=NC(=Cc3ccc4c(c3)OCO4)C(=O)N2c2ccc(C)cc2)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H24N4O7S/c1-16-4-7-19(8-5-16)31-27(34)21(11-18-6-9-23-25(12-18)39-15-38-23)30-28(31)40-14-26(33)29-20-13-24(37-3)22(32(35)36)10-17(20)2/h4-13H,14-15H2,1-3H3,(H,29,33) |
| InChIKey | QZRQYPQOVKGTCS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|